C31H33NO4 — CID 69110587
2-[1-[4-[6-methoxy-2-(3-methoxyphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]piperidine (PubChem CID 69110587) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[1-[4-[6-methoxy-2-(3-methoxyphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]piperidine.
| Compound Name | 2-[1-[4-[6-methoxy-2-(3-methoxyphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 69110587 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[1-[4-[6-methoxy-2-(3-methoxyphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]piperidine |
| SMILES | COc1cccc(-c2ccc3cc(OC)ccc3c2Oc2ccc(OC(C)C3CCCCN3)cc2)c1 |
| InChI | InChI=1S/C31H33NO4/c1-21(30-9-4-5-18-32-30)35-24-11-13-25(14-12-24)36-31-28(22-7-6-8-26(19-22)33-2)16-10-23-20-27(34-3)15-17-29(23)31/h6-8,10-17,19-21,30,32H,4-5,9,18H2,1-3H3 |
| InChIKey | YLBAXQZJTSZVHI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |