C24H22FNO2 — CID 69111012
3-(4-fluorophenyl)-4-(4-hydroxyphenyl)-1-(3-phenylpropyl)azetidin-2-one (PubChem CID 69111012) has the molecular formula C24H22FNO2 and a molecular weight of 375.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-(4-hydroxyphenyl)-1-(3-phenylpropyl)azetidin-2-one.
| Compound Name | 3-(4-fluorophenyl)-4-(4-hydroxyphenyl)-1-(3-phenylpropyl)azetidin-2-one |
|---|---|
| PubChem CID | 69111012 |
| Molecular Formula | C24H22FNO2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-(4-fluorophenyl)-4-(4-hydroxyphenyl)-1-(3-phenylpropyl)azetidin-2-one |
| SMILES | O=C1C(c2ccc(F)cc2)C(c2ccc(O)cc2)N1CCCc1ccccc1 |
| InChI | InChI=1S/C24H22FNO2/c25-20-12-8-18(9-13-20)22-23(19-10-14-21(27)15-11-19)26(24(22)28)16-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-15,22-23,27H,4,7,16H2 |
| InChIKey | WGYKAHRHRQODEJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |