C24H29FN2O4S — CID 54453930
2-[2-benzylsulfonyl-1-[6-(4-fluorophenyl)hexyl]-4-oxoazetidin-3-yl]acetamide (PubChem CID 54453930) has the molecular formula C24H29FN2O4S and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-[2-benzylsulfonyl-1-[6-(4-fluorophenyl)hexyl]-4-oxoazetidin-3-yl]acetamide.
| Compound Name | 2-[2-benzylsulfonyl-1-[6-(4-fluorophenyl)hexyl]-4-oxoazetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 54453930 |
| Molecular Formula | C24H29FN2O4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-[2-benzylsulfonyl-1-[6-(4-fluorophenyl)hexyl]-4-oxoazetidin-3-yl]acetamide |
| SMILES | NC(=O)CC1C(=O)N(CCCCCCc2ccc(F)cc2)C1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H29FN2O4S/c25-20-13-11-18(12-14-20)8-4-1-2-7-15-27-23(29)21(16-22(26)28)24(27)32(30,31)17-19-9-5-3-6-10-19/h3,5-6,9-14,21,24H,1-2,4,7-8,15-17H2,(H2,26,28) |
| InChIKey | WWVVBVNZGFANRQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|