C24H28N4O6S — CID 45377027
2-[1-benzylsulfonyl-4,7-dioxo-8-(3-phenylpropyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-6-yl]acetamide (PubChem CID 45377027) has the molecular formula C24H28N4O6S and a molecular weight of 500.58 g/mol. Its IUPAC name is 2-[1-benzylsulfonyl-4,7-dioxo-8-(3-phenylpropyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-6-yl]acetamide.
| Compound Name | 2-[1-benzylsulfonyl-4,7-dioxo-8-(3-phenylpropyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-6-yl]acetamide |
|---|---|
| PubChem CID | 45377027 |
| Molecular Formula | C24H28N4O6S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 2-[1-benzylsulfonyl-4,7-dioxo-8-(3-phenylpropyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazin-6-yl]acetamide |
| SMILES | NC(=O)CC1C(=O)N(CCCc2ccccc2)CC2N1C(=O)CON2S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H28N4O6S/c25-21(29)14-20-24(31)26(13-7-12-18-8-3-1-4-9-18)15-22-27(20)23(30)16-34-28(22)35(32,33)17-19-10-5-2-6-11-19/h1-6,8-11,20,22H,7,12-17H2,(H2,25,29) |
| InChIKey | YSLPJGYXMUCDQR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |