C29H37N3O5 — CID 10029244
2-(4-hydroxyphenyl)ethyl (6S,9aS)-4,7-dioxo-8-pentyl-6-(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 10029244) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl (6S,9aS)-4,7-dioxo-8-pentyl-6-(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | 2-(4-hydroxyphenyl)ethyl (6S,9aS)-4,7-dioxo-8-pentyl-6-(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 10029244 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl (6S,9aS)-4,7-dioxo-8-pentyl-6-(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | CCCCCN1C[C@@H]2N(C(=O)OCCc3ccc(O)cc3)CCC(=O)N2[C@@H](CCc2ccccc2)C1=O |
| InChI | InChI=1S/C29H37N3O5/c1-2-3-7-18-30-21-26-31(29(36)37-20-17-23-10-13-24(33)14-11-23)19-16-27(34)32(26)25(28(30)35)15-12-22-8-5-4-6-9-22/h4-6,8-11,13-14,25-26,33H,2-3,7,12,15-21H2,1H3/t25-,26+/m0/s1 |
| InChIKey | JRWQCSBKQKOWFS-IZZNHLLZSA-N |
| XLogP | 3.97 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|