C27H42N4O4 — CID 142885571
ethane;[(E)-hex-2-enyl] 6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 142885571) has the molecular formula C27H42N4O4 and a molecular weight of 486.66 g/mol. Its IUPAC name is ethane;[(E)-hex-2-enyl] 6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | ethane;[(E)-hex-2-enyl] 6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 142885571 |
| Molecular Formula | C27H42N4O4 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | ethane;[(E)-hex-2-enyl] 6-(4-aminobutyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | CC.CCC/C=C/COC(=O)N1CCC(=O)N2C(CCCCN)C(=O)N(Cc3ccccc3)CC12 |
| InChI | InChI=1S/C25H36N4O4.C2H6/c1-2-3-4-10-17-33-25(32)28-16-14-23(30)29-21(13-8-9-15-26)24(31)27(19-22(28)29)18-20-11-6-5-7-12-20;1-2/h4-7,10-12,21-22H,2-3,8-9,13-19,26H2,1H3;1-2H3/b10-4+; |
| InChIKey | CVQVQSDUDGNWOI-FCVRUTMISA-N |
| XLogP | 3.91 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|