C29H32F6N4O5 — CID 89290434
[3,5-bis(trifluoromethyl)phenyl]methyl (6S)-6-(4-aminobutyl)-8-[(2-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 89290434) has the molecular formula C29H32F6N4O5 and a molecular weight of 630.59 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-6-(4-aminobutyl)-8-[(2-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-6-(4-aminobutyl)-8-[(2-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 89290434 |
| Molecular Formula | C29H32F6N4O5 |
| Molecular Weight | 630.59 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-6-(4-aminobutyl)-8-[(2-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | COc1ccccc1CN1CC2N(C(=O)OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCC(=O)N2[C@@H](CCCCN)C1=O |
| InChI | InChI=1S/C29H32F6N4O5/c1-43-23-8-3-2-6-19(23)15-37-16-24-38(11-9-25(40)39(24)22(26(37)41)7-4-5-10-36)27(42)44-17-18-12-20(28(30,31)32)14-21(13-18)29(33,34)35/h2-3,6,8,12-14,22,24H,4-5,7,9-11,15-17,36H2,1H3/t22-,24?/m0/s1 |
| InChIKey | DZCSJKYHEUFUCQ-OWJIYDKWSA-N |
| XLogP | 4.77 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|