C28H29BrF6N4O4 — CID 89290561
[3,5-bis(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(4-aminobutyl)-8-[(2-bromophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 89290561) has the molecular formula C28H29BrF6N4O4 and a molecular weight of 679.46 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(4-aminobutyl)-8-[(2-bromophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(4-aminobutyl)-8-[(2-bromophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 89290561 |
| Molecular Formula | C28H29BrF6N4O4 |
| Molecular Weight | 679.46 g/mol |
| Exact Mass | 678.13 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(4-aminobutyl)-8-[(2-bromophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | NCCCC[C@H]1C(=O)N(Cc2ccccc2Br)C[C@@H]2N(C(=O)OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCC(=O)N21 |
| InChI | InChI=1S/C28H29BrF6N4O4/c29-21-6-2-1-5-18(21)14-37-15-23-38(10-8-24(40)39(23)22(25(37)41)7-3-4-9-36)26(42)43-16-17-11-19(27(30,31)32)13-20(12-17)28(33,34)35/h1-2,5-6,11-13,22-23H,3-4,7-10,14-16,36H2/t22-,23+/m0/s1 |
| InChIKey | YHIINUSGAYZBIU-XZOQPEGZSA-N |
| XLogP | 5.52 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|