C26H26F6N4O4 — CID 10008248
[3,5-bis(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(2-aminoethyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 10008248) has the molecular formula C26H26F6N4O4 and a molecular weight of 572.51 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(2-aminoethyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(2-aminoethyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 10008248 |
| Molecular Formula | C26H26F6N4O4 |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(2-aminoethyl)-8-benzyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | NCC[C@H]1C(=O)N(Cc2ccccc2)C[C@@H]2N(C(=O)OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCC(=O)N21 |
| InChI | InChI=1S/C26H26F6N4O4/c27-25(28,29)18-10-17(11-19(12-18)26(30,31)32)15-40-24(39)35-9-7-22(37)36-20(6-8-33)23(38)34(14-21(35)36)13-16-4-2-1-3-5-16/h1-5,10-12,20-21H,6-9,13-15,33H2/t20-,21+/m0/s1 |
| InChIKey | ACUKSLPSRUTZDP-LEWJYISDSA-N |
| XLogP | 3.98 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |