C29H30F6N4O4 — CID 142885475
[3,5-bis(trifluoromethyl)phenyl]methyl (6S)-8-benzyl-6-[2-(cyclopropylamino)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 142885475) has the molecular formula C29H30F6N4O4 and a molecular weight of 612.57 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-8-benzyl-6-[2-(cyclopropylamino)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-8-benzyl-6-[2-(cyclopropylamino)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 142885475 |
| Molecular Formula | C29H30F6N4O4 |
| Molecular Weight | 612.57 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (6S)-8-benzyl-6-[2-(cyclopropylamino)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | O=C1[C@H](CCNC2CC2)N2C(=O)CCN(C(=O)OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2CN1Cc1ccccc1 |
| InChI | InChI=1S/C29H30F6N4O4/c30-28(31,32)20-12-19(13-21(14-20)29(33,34)35)17-43-27(42)38-11-9-25(40)39-23(8-10-36-22-6-7-22)26(41)37(16-24(38)39)15-18-4-2-1-3-5-18/h1-5,12-14,22-24,36H,6-11,15-17H2/t23-,24?/m0/s1 |
| InChIKey | QPTWRZBMHJMOEG-UXMRNZNESA-N |
| XLogP | 4.77 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |