C26H26BrF4N3O4 — CID 59679185
[3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(2-bromoethyl)-8-[(4-fluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 59679185) has the molecular formula C26H26BrF4N3O4 and a molecular weight of 600.41 g/mol. Its IUPAC name is [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(2-bromoethyl)-8-[(4-fluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(2-bromoethyl)-8-[(4-fluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 59679185 |
| Molecular Formula | C26H26BrF4N3O4 |
| Molecular Weight | 600.41 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(2-bromoethyl)-8-[(4-fluorophenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | Cc1cc(COC(=O)N2CCC(=O)N3[C@@H]2CN(Cc2ccc(F)cc2)C(=O)[C@@H]3CCBr)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26BrF4N3O4/c1-16-10-18(12-19(11-16)26(29,30)31)15-38-25(37)33-9-7-23(35)34-21(6-8-27)24(36)32(14-22(33)34)13-17-2-4-20(28)5-3-17/h2-5,10-12,21-22H,6-9,13-15H2,1H3/t21-,22+/m0/s1 |
| InChIKey | UOIJJMAIAQGBLQ-FCHUYYIVSA-N |
| XLogP | 4.85 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|