C29H35F3N4O5 — CID 59679022
[3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(4-aminobutyl)-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 59679022) has the molecular formula C29H35F3N4O5 and a molecular weight of 576.62 g/mol. Its IUPAC name is [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(4-aminobutyl)-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(4-aminobutyl)-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 59679022 |
| Molecular Formula | C29H35F3N4O5 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-6-(4-aminobutyl)-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | COc1ccc(CN2C[C@@H]3N(C(=O)OCc4cc(C)cc(C(F)(F)F)c4)CCC(=O)N3[C@@H](CCCCN)C2=O)cc1 |
| InChI | InChI=1S/C29H35F3N4O5/c1-19-13-21(15-22(14-19)29(30,31)32)18-41-28(39)35-12-10-26(37)36-24(5-3-4-11-33)27(38)34(17-25(35)36)16-20-6-8-23(40-2)9-7-20/h6-9,13-15,24-25H,3-5,10-12,16-18,33H2,1-2H3/t24-,25+/m0/s1 |
| InChIKey | FBWCGLSRPHSZMR-LOSJGSFVSA-N |
| XLogP | 4.06 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|