C29H33F3N4O4 — CID 59679088
[3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-8-benzyl-6-[2-(2-methylaziridin-1-yl)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 59679088) has the molecular formula C29H33F3N4O4 and a molecular weight of 558.60 g/mol. Its IUPAC name is [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-8-benzyl-6-[2-(2-methylaziridin-1-yl)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-8-benzyl-6-[2-(2-methylaziridin-1-yl)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 59679088 |
| Molecular Formula | C29H33F3N4O4 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | [3-methyl-5-(trifluoromethyl)phenyl]methyl (6S,9aS)-8-benzyl-6-[2-(2-methylaziridin-1-yl)ethyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | Cc1cc(COC(=O)N2CCC(=O)N3[C@@H]2CN(Cc2ccccc2)C(=O)[C@@H]3CCN2CC2C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H33F3N4O4/c1-19-12-22(14-23(13-19)29(30,31)32)18-40-28(39)35-11-9-26(37)36-24(8-10-33-15-20(33)2)27(38)34(17-25(35)36)16-21-6-4-3-5-7-21/h3-7,12-14,20,24-25H,8-11,15-18H2,1-2H3/t20?,24-,25+,33?/m0/s1 |
| InChIKey | WAMJETXYFAZKOY-WRMWSZCNSA-N |
| XLogP | 4.02 |
| TPSA | 73.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|