C28H36F3N5O3 — CID 158453367
(6S)-6-(3-aminopropyl)-8-benzyl-N-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide;methane (PubChem CID 158453367) has the molecular formula C28H36F3N5O3 and a molecular weight of 547.62 g/mol. Its IUPAC name is (6S)-6-(3-aminopropyl)-8-benzyl-N-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide;methane.
| Compound Name | (6S)-6-(3-aminopropyl)-8-benzyl-N-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide;methane |
|---|---|
| PubChem CID | 158453367 |
| Molecular Formula | C28H36F3N5O3 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | (6S)-6-(3-aminopropyl)-8-benzyl-N-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxamide;methane |
| SMILES | C.Cc1cc(CNC(=O)N2CCC(=O)N3C2CN(Cc2ccccc2)C(=O)[C@@H]3CCCN)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H32F3N5O3.CH4/c1-18-12-20(14-21(13-18)27(28,29)30)15-32-26(38)34-11-9-24(36)35-22(8-5-10-31)25(37)33(17-23(34)35)16-19-6-3-2-4-7-19;/h2-4,6-7,12-14,22-23H,5,8-11,15-17,31H2,1H3,(H,32,38);1H4/t22-,23?;/m0./s1 |
| InChIKey | HEGSJWQVPJAWAO-OSMMWLIYSA-N |
| XLogP | 3.87 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |