C30H38FN5O5 — CID 70987994
2-[(6S)-1-(butylcarbamoyl)-2-[(3-fluorophenyl)methyl]-4,7-dioxo-8-(4-phenylbutyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid (PubChem CID 70987994) has the molecular formula C30H38FN5O5 and a molecular weight of 567.66 g/mol. Its IUPAC name is 2-[(6S)-1-(butylcarbamoyl)-2-[(3-fluorophenyl)methyl]-4,7-dioxo-8-(4-phenylbutyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid.
| Compound Name | 2-[(6S)-1-(butylcarbamoyl)-2-[(3-fluorophenyl)methyl]-4,7-dioxo-8-(4-phenylbutyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
|---|---|
| PubChem CID | 70987994 |
| Molecular Formula | C30H38FN5O5 |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | 2-[(6S)-1-(butylcarbamoyl)-2-[(3-fluorophenyl)methyl]-4,7-dioxo-8-(4-phenylbutyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
| SMILES | CCCCNC(=O)N1C2CN(CCCCc3ccccc3)C(=O)[C@H](CC(=O)O)N2C(=O)CN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C30H38FN5O5/c1-2-3-15-32-30(41)36-26-20-33(16-8-7-12-22-10-5-4-6-11-22)29(40)25(18-28(38)39)35(26)27(37)21-34(36)19-23-13-9-14-24(31)17-23/h4-6,9-11,13-14,17,25-26H,2-3,7-8,12,15-16,18-21H2,1H3,(H,32,41)(H,38,39)/t25-,26?/m0/s1 |
| InChIKey | SGIITZYNDNPZGI-PMCHYTPCSA-N |
| XLogP | 3.23 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|