C31H27F2NO2 — CID 69246279
3-(4-fluorophenyl)-1-[1-(4-fluorophenyl)propyl]-4-(4-phenylmethoxyphenyl)azetidin-2-one (PubChem CID 69246279) has the molecular formula C31H27F2NO2 and a molecular weight of 483.56 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[1-(4-fluorophenyl)propyl]-4-(4-phenylmethoxyphenyl)azetidin-2-one.
| Compound Name | 3-(4-fluorophenyl)-1-[1-(4-fluorophenyl)propyl]-4-(4-phenylmethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 69246279 |
| Molecular Formula | C31H27F2NO2 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[1-(4-fluorophenyl)propyl]-4-(4-phenylmethoxyphenyl)azetidin-2-one |
| SMILES | CCC(c1ccc(F)cc1)N1C(=O)C(c2ccc(F)cc2)C1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H27F2NO2/c1-2-28(22-8-14-25(32)15-9-22)34-30(29(31(34)35)23-10-16-26(33)17-11-23)24-12-18-27(19-13-24)36-20-21-6-4-3-5-7-21/h3-19,28-30H,2,20H2,1H3 |
| InChIKey | CDIFKIXIMKKQIK-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |