C23H26ClIN4O — CID 69112005
(3R,4S)-N-(azepan-1-yl)-2-(2-chlorophenyl)-3-(4-iodophenyl)-4-methyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 69112005) has the molecular formula C23H26ClIN4O and a molecular weight of 536.85 g/mol. Its IUPAC name is (3R,4S)-N-(azepan-1-yl)-2-(2-chlorophenyl)-3-(4-iodophenyl)-4-methyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3R,4S)-N-(azepan-1-yl)-2-(2-chlorophenyl)-3-(4-iodophenyl)-4-methyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69112005 |
| Molecular Formula | C23H26ClIN4O |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | (3R,4S)-N-(azepan-1-yl)-2-(2-chlorophenyl)-3-(4-iodophenyl)-4-methyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | C[C@@H]1C(C(=O)NN2CCCCCC2)=NN(c2ccccc2Cl)[C@H]1c1ccc(I)cc1 |
| InChI | InChI=1S/C23H26ClIN4O/c1-16-21(23(30)27-28-14-6-2-3-7-15-28)26-29(20-9-5-4-8-19(20)24)22(16)17-10-12-18(25)13-11-17/h4-5,8-13,16,22H,2-3,6-7,14-15H2,1H3,(H,27,30)/t16-,22-/m1/s1 |
| InChIKey | CGTXYNIJYFRQRS-OPAMFIHVSA-N |
| XLogP | 5.41 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|