C24H26ClIN4O — CID 69112621
(3R,4R)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2-chlorophenyl)-3-(4-iodophenyl)-4-methyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 69112621) has the molecular formula C24H26ClIN4O and a molecular weight of 548.86 g/mol. Its IUPAC name is (3R,4R)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2-chlorophenyl)-3-(4-iodophenyl)-4-methyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3R,4R)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2-chlorophenyl)-3-(4-iodophenyl)-4-methyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69112621 |
| Molecular Formula | C24H26ClIN4O |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | (3R,4R)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2-chlorophenyl)-3-(4-iodophenyl)-4-methyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | C[C@H]1C(C(=O)NN2CC3CCCC3C2)=NN(c2ccccc2Cl)[C@H]1c1ccc(I)cc1 |
| InChI | InChI=1S/C24H26ClIN4O/c1-15-22(24(31)28-29-13-17-5-4-6-18(17)14-29)27-30(21-8-3-2-7-20(21)25)23(15)16-9-11-19(26)12-10-16/h2-3,7-12,15,17-18,23H,4-6,13-14H2,1H3,(H,28,31)/t15-,17?,18?,23+/m0/s1 |
| InChIKey | LAWKAEQITQULEB-GCZNWIFXSA-N |
| XLogP | 5.26 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|