C25H27BrCl2N4O — CID 69112485
(3S,4S)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 69112485) has the molecular formula C25H27BrCl2N4O and a molecular weight of 550.33 g/mol. Its IUPAC name is (3S,4S)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3S,4S)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69112485 |
| Molecular Formula | C25H27BrCl2N4O |
| Molecular Weight | 550.33 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | (3S,4S)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CC[C@@H]1C(C(=O)NN2CC3CCCC3C2)=NN(c2ccc(Cl)cc2Cl)[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H27BrCl2N4O/c1-2-20-23(25(33)30-31-13-16-4-3-5-17(16)14-31)29-32(22-11-10-19(27)12-21(22)28)24(20)15-6-8-18(26)9-7-15/h6-12,16-17,20,24H,2-5,13-14H2,1H3,(H,30,33)/t16?,17?,20-,24-/m1/s1 |
| InChIKey | VQXAECVSHJYGSU-WBIUCTKCSA-N |
| XLogP | 6.46 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.33 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |