C18H14BrCl3N2O — CID 87118573
(3S,4S)-3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carbonyl chloride (PubChem CID 87118573) has the molecular formula C18H14BrCl3N2O and a molecular weight of 460.59 g/mol. Its IUPAC name is (3S,4S)-3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carbonyl chloride.
| Compound Name | (3S,4S)-3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 87118573 |
| Molecular Formula | C18H14BrCl3N2O |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 457.94 |
| IUPAC Name | (3S,4S)-3-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-ethyl-3,4-dihydropyrazole-5-carbonyl chloride |
| SMILES | CC[C@@H]1C(C(=O)Cl)=NN(c2ccc(Cl)cc2Cl)[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H14BrCl3N2O/c1-2-13-16(18(22)25)23-24(15-8-7-12(20)9-14(15)21)17(13)10-3-5-11(19)6-4-10/h3-9,13,17H,2H2,1H3/t13-,17-/m1/s1 |
| InChIKey | RSSYWABJIMQGRG-CXAGYDPISA-N |
| XLogP | 6.46 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|