C24H26Cl2N3OW- — CID 59829029
azepan-1-yl-[2-(2,4-dichlorophenyl)-4-ethyl-3-phenyl-3,4-dihydropyrazol-5-yl]methanone;tungsten (PubChem CID 59829029) has the molecular formula C24H26Cl2N3OW- and a molecular weight of 627.24 g/mol. Its IUPAC name is azepan-1-yl-[2-(2,4-dichlorophenyl)-4-ethyl-3-phenyl-3,4-dihydropyrazol-5-yl]methanone;tungsten.
| Compound Name | azepan-1-yl-[2-(2,4-dichlorophenyl)-4-ethyl-3-phenyl-3,4-dihydropyrazol-5-yl]methanone;tungsten |
|---|---|
| PubChem CID | 59829029 |
| Molecular Formula | C24H26Cl2N3OW- |
| Molecular Weight | 627.24 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | azepan-1-yl-[2-(2,4-dichlorophenyl)-4-ethyl-3-phenyl-3,4-dihydropyrazol-5-yl]methanone;tungsten |
| SMILES | CCC1C(C(=O)N2CCCCCC2)=NN(c2ccc(Cl)cc2Cl)C1c1cc[c-]cc1.[W] |
| InChI | InChI=1S/C24H26Cl2N3O.W/c1-2-19-22(24(30)28-14-8-3-4-9-15-28)27-29(21-13-12-18(25)16-20(21)26)23(19)17-10-6-5-7-11-17;/h6-7,10-13,16,19,23H,2-4,8-9,14-15H2,1H3;/q-1; |
| InChIKey | OXAPEVQVULEEJB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.24 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|