C23H26Cl2N4S — CID 57453067
N-(azepan-1-yl)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbothioamide (PubChem CID 57453067) has the molecular formula C23H26Cl2N4S and a molecular weight of 461.46 g/mol. Its IUPAC name is N-(azepan-1-yl)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbothioamide.
| Compound Name | N-(azepan-1-yl)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbothioamide |
|---|---|
| PubChem CID | 57453067 |
| Molecular Formula | C23H26Cl2N4S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-(azepan-1-yl)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbothioamide |
| SMILES | CC1C(C(=S)NN2CCCCCC2)=NN(c2ccccc2Cl)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26Cl2N4S/c1-16-21(23(30)27-28-14-6-2-3-7-15-28)26-29(20-9-5-4-8-19(20)25)22(16)17-10-12-18(24)13-11-17/h4-5,8-13,16,22H,2-3,6-7,14-15H2,1H3,(H,27,30) |
| InChIKey | MJRKUISBXSLEEZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|