C23H26Cl2N4O2 — CID 87698735
N-[(3S,4S)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbonyl]azepan-1-amine oxide (PubChem CID 87698735) has the molecular formula C23H26Cl2N4O2 and a molecular weight of 461.39 g/mol. Its IUPAC name is N-[(3S,4S)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbonyl]azepan-1-amine oxide.
| Compound Name | N-[(3S,4S)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbonyl]azepan-1-amine oxide |
|---|---|
| PubChem CID | 87698735 |
| Molecular Formula | C23H26Cl2N4O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[(3S,4S)-2-(2-chlorophenyl)-3-(4-chlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbonyl]azepan-1-amine oxide |
| SMILES | C[C@@H]1C(C(=O)[NH+]([O-])N2CCCCCC2)=NN(c2ccccc2Cl)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26Cl2N4O2/c1-16-21(23(30)29(31)27-14-6-2-3-7-15-27)26-28(20-9-5-4-8-19(20)25)22(16)17-10-12-18(24)13-11-17/h4-5,8-13,16,22,29H,2-3,6-7,14-15H2,1H3/t16-,22+/m1/s1 |
| InChIKey | BRVPJNPGSXSLBQ-ZHRRBRCNSA-N |
| XLogP | 4.25 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|