C23H27ClN4OS — CID 87698983
(3R,4S)-2-(2-chlorophenyl)-3-(4-methoxyphenyl)-4-methyl-N-piperidin-1-yl-3,4-dihydropyrazole-5-carbothioamide (PubChem CID 87698983) has the molecular formula C23H27ClN4OS and a molecular weight of 443.02 g/mol. Its IUPAC name is (3R,4S)-2-(2-chlorophenyl)-3-(4-methoxyphenyl)-4-methyl-N-piperidin-1-yl-3,4-dihydropyrazole-5-carbothioamide.
| Compound Name | (3R,4S)-2-(2-chlorophenyl)-3-(4-methoxyphenyl)-4-methyl-N-piperidin-1-yl-3,4-dihydropyrazole-5-carbothioamide |
|---|---|
| PubChem CID | 87698983 |
| Molecular Formula | C23H27ClN4OS |
| Molecular Weight | 443.02 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (3R,4S)-2-(2-chlorophenyl)-3-(4-methoxyphenyl)-4-methyl-N-piperidin-1-yl-3,4-dihydropyrazole-5-carbothioamide |
| SMILES | COc1ccc([C@H]2[C@H](C)C(C(=S)NN3CCCCC3)=NN2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H27ClN4OS/c1-16-21(23(30)26-27-14-6-3-7-15-27)25-28(20-9-5-4-8-19(20)24)22(16)17-10-12-18(29-2)13-11-17/h4-5,8-13,16,22H,3,6-7,14-15H2,1-2H3,(H,26,30)/t16-,22-/m1/s1 |
| InChIKey | WAJDQMWNKJXIPY-OPAMFIHVSA-N |
| XLogP | 5.22 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|