C18H20FN3O3 — CID 69114050
[2-[[3-(2,2-dimethoxyethyl)-2H-indazol-5-yl]oxy]-5-fluorophenyl]methanamine (PubChem CID 69114050) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is [2-[[3-(2,2-dimethoxyethyl)-2H-indazol-5-yl]oxy]-5-fluorophenyl]methanamine.
| Compound Name | [2-[[3-(2,2-dimethoxyethyl)-2H-indazol-5-yl]oxy]-5-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 69114050 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [2-[[3-(2,2-dimethoxyethyl)-2H-indazol-5-yl]oxy]-5-fluorophenyl]methanamine |
| SMILES | COC(Cc1[nH]nc2ccc(Oc3ccc(F)cc3CN)cc12)OC |
| InChI | InChI=1S/C18H20FN3O3/c1-23-18(24-2)9-16-14-8-13(4-5-15(14)21-22-16)25-17-6-3-12(19)7-11(17)10-20/h3-8,18H,9-10,20H2,1-2H3,(H,21,22) |
| InChIKey | SAEATPSIUGDZPX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|