C29H39N5O5S — CID 69117589
N-[6-amino-1-[[(2S)-1-[[(3S)-2-hydroxyoxolan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-10H-phenothiazine-2-carboxamide (PubChem CID 69117589) has the molecular formula C29H39N5O5S and a molecular weight of 569.73 g/mol. Its IUPAC name is N-[6-amino-1-[[(2S)-1-[[(3S)-2-hydroxyoxolan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-10H-phenothiazine-2-carboxamide.
| Compound Name | N-[6-amino-1-[[(2S)-1-[[(3S)-2-hydroxyoxolan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-10H-phenothiazine-2-carboxamide |
|---|---|
| PubChem CID | 69117589 |
| Molecular Formula | C29H39N5O5S |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | N-[6-amino-1-[[(2S)-1-[[(3S)-2-hydroxyoxolan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-10H-phenothiazine-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)C(CCCCN)NC(=O)c1ccc2c(c1)Nc1ccccc1S2)C(=O)N[C@H]1CCOC1O |
| InChI | InChI=1S/C29H39N5O5S/c1-17(2)15-23(28(37)33-21-12-14-39-29(21)38)34-27(36)20(8-5-6-13-30)32-26(35)18-10-11-25-22(16-18)31-19-7-3-4-9-24(19)40-25/h3-4,7,9-11,16-17,20-21,23,29,31,38H,5-6,8,12-15,30H2,1-2H3,(H,32,35)(H,33,37)(H,34,36)/t20?,21-,23-,29?/m0/s1 |
| InChIKey | INZDEWVIAYHBTC-ZWDDOBEASA-N |
| XLogP | 2.88 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|