C38H47N5O7S — CID 69117797
benzyl N-[(2S)-2-[[(2S)-6-amino-2-(10H-phenothiazine-2-carbonylamino)hexanoyl]amino]-4-methylpentanoyl]-N-[(3S)-2-methoxyoxolan-3-yl]carbamate (PubChem CID 69117797) has the molecular formula C38H47N5O7S and a molecular weight of 717.89 g/mol. Its IUPAC name is benzyl N-[(2S)-2-[[(2S)-6-amino-2-(10H-phenothiazine-2-carbonylamino)hexanoyl]amino]-4-methylpentanoyl]-N-[(3S)-2-methoxyoxolan-3-yl]carbamate.
| Compound Name | benzyl N-[(2S)-2-[[(2S)-6-amino-2-(10H-phenothiazine-2-carbonylamino)hexanoyl]amino]-4-methylpentanoyl]-N-[(3S)-2-methoxyoxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 69117797 |
| Molecular Formula | C38H47N5O7S |
| Molecular Weight | 717.89 g/mol |
| Exact Mass | 717.32 |
| IUPAC Name | benzyl N-[(2S)-2-[[(2S)-6-amino-2-(10H-phenothiazine-2-carbonylamino)hexanoyl]amino]-4-methylpentanoyl]-N-[(3S)-2-methoxyoxolan-3-yl]carbamate |
| SMILES | COC1OCC[C@@H]1N(C(=O)OCc1ccccc1)C(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C38H47N5O7S/c1-24(2)21-30(36(46)43(31-18-20-49-37(31)48-3)38(47)50-23-25-11-5-4-6-12-25)42-35(45)28(14-9-10-19-39)41-34(44)26-16-17-33-29(22-26)40-27-13-7-8-15-32(27)51-33/h4-8,11-13,15-17,22,24,28,30-31,37,40H,9-10,14,18-21,23,39H2,1-3H3,(H,41,44)(H,42,45)/t28-,30-,31-,37?/m0/s1 |
| InChIKey | BVWDYTKVKMZWSM-HURCAPFYSA-N |
| XLogP | 5.58 |
| TPSA | 161.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.89 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|