C28H37N3O5S — CID 69196278
N-[(3S)-2-methoxyoxolan-3-yl]-4-methyl-2-[3-[[2-(10H-phenothiazin-2-yloxy)acetyl]amino]propyl]pentanamide (PubChem CID 69196278) has the molecular formula C28H37N3O5S and a molecular weight of 527.69 g/mol. Its IUPAC name is N-[(3S)-2-methoxyoxolan-3-yl]-4-methyl-2-[3-[[2-(10H-phenothiazin-2-yloxy)acetyl]amino]propyl]pentanamide.
| Compound Name | N-[(3S)-2-methoxyoxolan-3-yl]-4-methyl-2-[3-[[2-(10H-phenothiazin-2-yloxy)acetyl]amino]propyl]pentanamide |
|---|---|
| PubChem CID | 69196278 |
| Molecular Formula | C28H37N3O5S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | N-[(3S)-2-methoxyoxolan-3-yl]-4-methyl-2-[3-[[2-(10H-phenothiazin-2-yloxy)acetyl]amino]propyl]pentanamide |
| SMILES | COC1OCC[C@@H]1NC(=O)C(CCCNC(=O)COc1ccc2c(c1)Nc1ccccc1S2)CC(C)C |
| InChI | InChI=1S/C28H37N3O5S/c1-18(2)15-19(27(33)31-22-12-14-35-28(22)34-3)7-6-13-29-26(32)17-36-20-10-11-25-23(16-20)30-21-8-4-5-9-24(21)37-25/h4-5,8-11,16,18-19,22,28,30H,6-7,12-15,17H2,1-3H3,(H,29,32)(H,31,33)/t19?,22-,28?/m0/s1 |
| InChIKey | GURVKDPMYKZJIM-JKLGZZSBSA-N |
| XLogP | 4.71 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|