C34H37IN4O3S — CID 68704583
(2S)-2-[[amino(10H-phenothiazin-2-yl)methylidene]amino]-4-methyl-N-[(3S)-2-(naphthalen-2-ylmethoxy)oxolan-3-yl]pentanamide;hydroiodide (PubChem CID 68704583) has the molecular formula C34H37IN4O3S and a molecular weight of 708.67 g/mol. Its IUPAC name is (2S)-2-[[amino(10H-phenothiazin-2-yl)methylidene]amino]-4-methyl-N-[(3S)-2-(naphthalen-2-ylmethoxy)oxolan-3-yl]pentanamide;hydroiodide.
| Compound Name | (2S)-2-[[amino(10H-phenothiazin-2-yl)methylidene]amino]-4-methyl-N-[(3S)-2-(naphthalen-2-ylmethoxy)oxolan-3-yl]pentanamide;hydroiodide |
|---|---|
| PubChem CID | 68704583 |
| Molecular Formula | C34H37IN4O3S |
| Molecular Weight | 708.67 g/mol |
| Exact Mass | 708.16 |
| IUPAC Name | (2S)-2-[[amino(10H-phenothiazin-2-yl)methylidene]amino]-4-methyl-N-[(3S)-2-(naphthalen-2-ylmethoxy)oxolan-3-yl]pentanamide;hydroiodide |
| SMILES | CC(C)C[C@H](/N=C(\N)c1ccc2c(c1)Nc1ccccc1S2)C(=O)N[C@H]1CCOC1OCc1ccc2ccccc2c1.I |
| InChI | InChI=1S/C34H36N4O3S.HI/c1-21(2)17-29(37-32(35)25-13-14-31-28(19-25)36-26-9-5-6-10-30(26)42-31)33(39)38-27-15-16-40-34(27)41-20-22-11-12-23-7-3-4-8-24(23)18-22;/h3-14,18-19,21,27,29,34,36H,15-17,20H2,1-2H3,(H2,35,37)(H,38,39);1H/t27-,29-,34?;/m0./s1 |
| InChIKey | YCGBMDUDBSDSEJ-PQEVNSJTSA-N |
| XLogP | 7.23 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.67 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|