C18H18N2O3 — CID 69120247
methyl 2-[4-[(5-amino-1H-indol-3-yl)methyl]phenoxy]acetate (PubChem CID 69120247) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl 2-[4-[(5-amino-1H-indol-3-yl)methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(5-amino-1H-indol-3-yl)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 69120247 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | methyl 2-[4-[(5-amino-1H-indol-3-yl)methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(Cc2c[nH]c3ccc(N)cc23)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-22-18(21)11-23-15-5-2-12(3-6-15)8-13-10-20-17-7-4-14(19)9-16(13)17/h2-7,9-10,20H,8,11,19H2,1H3 |
| InChIKey | LBUFYCARIMYOTN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|