C17H17N3OS — CID 157140650
4-[(5-methylsulfanyl-1H-indol-3-yl)methyl]benzohydrazide (PubChem CID 157140650) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-[(5-methylsulfanyl-1H-indol-3-yl)methyl]benzohydrazide.
| Compound Name | 4-[(5-methylsulfanyl-1H-indol-3-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 157140650 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-[(5-methylsulfanyl-1H-indol-3-yl)methyl]benzohydrazide |
| SMILES | CSc1ccc2[nH]cc(Cc3ccc(C(=O)NN)cc3)c2c1 |
| InChI | InChI=1S/C17H17N3OS/c1-22-14-6-7-16-15(9-14)13(10-19-16)8-11-2-4-12(5-3-11)17(21)20-18/h2-7,9-10,19H,8,18H2,1H3,(H,20,21) |
| InChIKey | YQQXEQQJOVBVAD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|