C23H43N2O2+ — CID 6913075
2-[2-[(Z)-hexadec-7-enyl]-1-(2-hydroxyethyl)imidazol-1-ium-1-yl]ethanol (PubChem CID 6913075) has the molecular formula C23H43N2O2+ and a molecular weight of 379.61 g/mol. Its IUPAC name is 2-[2-[(Z)-hexadec-7-enyl]-1-(2-hydroxyethyl)imidazol-1-ium-1-yl]ethanol.
| Compound Name | 2-[2-[(Z)-hexadec-7-enyl]-1-(2-hydroxyethyl)imidazol-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 6913075 |
| Molecular Formula | C23H43N2O2+ |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.33 |
| IUPAC Name | 2-[2-[(Z)-hexadec-7-enyl]-1-(2-hydroxyethyl)imidazol-1-ium-1-yl]ethanol |
| SMILES | CCCCCCCC/C=C\CCCCCCC1=NC=C[N+]1(CCO)CCO |
| InChI | InChI=1S/C23H43N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23-24-17-18-25(23,19-21-26)20-22-27/h9-10,17-18,26-27H,2-8,11-16,19-22H2,1H3/q+1/b10-9- |
| InChIKey | SZSUIMICKMQMTH-KTKRTIGZSA-N |
| XLogP | 5.32 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|