C30H33N5O5S — CID 69134957
4-methoxy-N-[4-[[6-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrimidin-4-yl]amino]phenyl]benzenesulfonamide (PubChem CID 69134957) has the molecular formula C30H33N5O5S and a molecular weight of 575.69 g/mol. Its IUPAC name is 4-methoxy-N-[4-[[6-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrimidin-4-yl]amino]phenyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[4-[[6-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrimidin-4-yl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69134957 |
| Molecular Formula | C30H33N5O5S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 4-methoxy-N-[4-[[6-[3-(3-morpholin-4-ylpropoxy)phenyl]pyrimidin-4-yl]amino]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(-c4cccc(OCCCN5CCOCC5)c4)ncn3)cc2)cc1 |
| InChI | InChI=1S/C30H33N5O5S/c1-38-26-10-12-28(13-11-26)41(36,37)34-25-8-6-24(7-9-25)33-30-21-29(31-22-32-30)23-4-2-5-27(20-23)40-17-3-14-35-15-18-39-19-16-35/h2,4-13,20-22,34H,3,14-19H2,1H3,(H,31,32,33) |
| InChIKey | VVPSXRXAIOEDSF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|