C22H21ClO4 — CID 69136162
(5S)-3-[(2R)-3-(4-chlorophenyl)-1-hydroxy-2-methylpropylidene]-5-(2-phenylethyl)oxolane-2,4-dione (PubChem CID 69136162) has the molecular formula C22H21ClO4 and a molecular weight of 384.86 g/mol. Its IUPAC name is (5S)-3-[(2R)-3-(4-chlorophenyl)-1-hydroxy-2-methylpropylidene]-5-(2-phenylethyl)oxolane-2,4-dione.
| Compound Name | (5S)-3-[(2R)-3-(4-chlorophenyl)-1-hydroxy-2-methylpropylidene]-5-(2-phenylethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 69136162 |
| Molecular Formula | C22H21ClO4 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (5S)-3-[(2R)-3-(4-chlorophenyl)-1-hydroxy-2-methylpropylidene]-5-(2-phenylethyl)oxolane-2,4-dione |
| SMILES | C[C@H](Cc1ccc(Cl)cc1)C(O)=C1C(=O)O[C@@H](CCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H21ClO4/c1-14(13-16-7-10-17(23)11-8-16)20(24)19-21(25)18(27-22(19)26)12-9-15-5-3-2-4-6-15/h2-8,10-11,14,18,24H,9,12-13H2,1H3/t14-,18+/m1/s1 |
| InChIKey | GWLAGWAXAFYJFM-KDOFPFPSSA-N |
| XLogP | 4.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|