C17H15F2N — CID 69139327
(2R)-2,4-bis(4-fluorophenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 69139327) has the molecular formula C17H15F2N and a molecular weight of 271.31 g/mol. Its IUPAC name is (2R)-2,4-bis(4-fluorophenyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | (2R)-2,4-bis(4-fluorophenyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 69139327 |
| Molecular Formula | C17H15F2N |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2R)-2,4-bis(4-fluorophenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | Fc1ccc(C2=CCN[C@@H](c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C17H15F2N/c18-15-5-1-12(2-6-15)14-9-10-20-17(11-14)13-3-7-16(19)8-4-13/h1-9,17,20H,10-11H2/t17-/m1/s1 |
| InChIKey | YKZMGUOGSVRZNH-QGZVFWFLSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |