C23H28FN5O2 — CID 69140010
3-[3-[1-(4-fluorophenyl)nonan-5-yl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione (PubChem CID 69140010) has the molecular formula C23H28FN5O2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[3-[1-(4-fluorophenyl)nonan-5-yl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione.
| Compound Name | 3-[3-[1-(4-fluorophenyl)nonan-5-yl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 69140010 |
| Molecular Formula | C23H28FN5O2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 3-[3-[1-(4-fluorophenyl)nonan-5-yl]-1H-pyrrol-2-yl]-1-(2H-tetrazol-5-yl)propane-1,2-dione |
| SMILES | CCCCC(CCCCc1ccc(F)cc1)c1cc[nH]c1CC(=O)C(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C23H28FN5O2/c1-2-3-7-17(8-5-4-6-16-9-11-18(24)12-10-16)19-13-14-25-20(19)15-21(30)22(31)23-26-28-29-27-23/h9-14,17,25H,2-8,15H2,1H3,(H,26,27,28,29) |
| InChIKey | NJDBFPFSBVIXDN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|