C24H31FN6O4 — CID 69140625
(2S)-2-[[[(2R)-2-aminobutanoyl]amino]carbamoylamino]-N-[(2S)-1-amino-3-(3-fluorophenyl)-1-oxopropan-2-yl]-4-phenylbutanamide (PubChem CID 69140625) has the molecular formula C24H31FN6O4 and a molecular weight of 486.55 g/mol. Its IUPAC name is (2S)-2-[[[(2R)-2-aminobutanoyl]amino]carbamoylamino]-N-[(2S)-1-amino-3-(3-fluorophenyl)-1-oxopropan-2-yl]-4-phenylbutanamide.
| Compound Name | (2S)-2-[[[(2R)-2-aminobutanoyl]amino]carbamoylamino]-N-[(2S)-1-amino-3-(3-fluorophenyl)-1-oxopropan-2-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 69140625 |
| Molecular Formula | C24H31FN6O4 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (2S)-2-[[[(2R)-2-aminobutanoyl]amino]carbamoylamino]-N-[(2S)-1-amino-3-(3-fluorophenyl)-1-oxopropan-2-yl]-4-phenylbutanamide |
| SMILES | CC[C@@H](N)C(=O)NNC(=O)N[C@@H](CCc1ccccc1)C(=O)N[C@@H](Cc1cccc(F)c1)C(N)=O |
| InChI | InChI=1S/C24H31FN6O4/c1-2-18(26)22(33)30-31-24(35)29-19(12-11-15-7-4-3-5-8-15)23(34)28-20(21(27)32)14-16-9-6-10-17(25)13-16/h3-10,13,18-20H,2,11-12,14,26H2,1H3,(H2,27,32)(H,28,34)(H,30,33)(H2,29,31,35)/t18-,19+,20+/m1/s1 |
| InChIKey | WCUZTSOTIQHYNL-AABGKKOBSA-N |
| XLogP | 0.41 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|