C14H9ClN4O5S — CID 69142033
1-[4-(4-chlorophenyl)sulfonylfuran-2-yl]-3-hydroxy-3-(2H-tetrazol-5-yl)prop-2-en-1-one (PubChem CID 69142033) has the molecular formula C14H9ClN4O5S and a molecular weight of 380.77 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)sulfonylfuran-2-yl]-3-hydroxy-3-(2H-tetrazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-[4-(4-chlorophenyl)sulfonylfuran-2-yl]-3-hydroxy-3-(2H-tetrazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69142033 |
| Molecular Formula | C14H9ClN4O5S |
| Molecular Weight | 380.77 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 1-[4-(4-chlorophenyl)sulfonylfuran-2-yl]-3-hydroxy-3-(2H-tetrazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1nn[nH]n1)c1cc(S(=O)(=O)c2ccc(Cl)cc2)co1 |
| InChI | InChI=1S/C14H9ClN4O5S/c15-8-1-3-9(4-2-8)25(22,23)10-5-13(24-7-10)11(20)6-12(21)14-16-18-19-17-14/h1-7,21H,(H,16,17,18,19) |
| InChIKey | ASRNNXHYXCUFQC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|