C28H37N3O2 — CID 69142749
N-[amino-[3-(1-phenylethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methyl]-2-cyclohexyl-2-hydroxy-2-phenylacetamide (PubChem CID 69142749) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is N-[amino-[3-(1-phenylethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methyl]-2-cyclohexyl-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[amino-[3-(1-phenylethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methyl]-2-cyclohexyl-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 69142749 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-[amino-[3-(1-phenylethyl)-3-azabicyclo[3.1.0]hexan-1-yl]methyl]-2-cyclohexyl-2-hydroxy-2-phenylacetamide |
| SMILES | CC(c1ccccc1)N1CC2CC2(C(N)NC(=O)C(O)(c2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C28H37N3O2/c1-20(21-11-5-2-6-12-21)31-18-24-17-27(24,19-31)25(29)30-26(32)28(33,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-3,5-8,11-14,20,23-25,33H,4,9-10,15-19,29H2,1H3,(H,30,32) |
| InChIKey | AZJYKTXHWKUKQY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|