C11H20N3O6P — CID 6914366
[(1S)-1-[[(6S)-6-[(2-aminoacetyl)amino]-6-carboxyhexanoyl]amino]ethyl]-oxido-oxophosphanium (PubChem CID 6914366) has the molecular formula C11H20N3O6P and a molecular weight of 321.27 g/mol. Its IUPAC name is [(1S)-1-[[(6S)-6-[(2-aminoacetyl)amino]-6-carboxyhexanoyl]amino]ethyl]-oxido-oxophosphanium.
| Compound Name | [(1S)-1-[[(6S)-6-[(2-aminoacetyl)amino]-6-carboxyhexanoyl]amino]ethyl]-oxido-oxophosphanium |
|---|---|
| PubChem CID | 6914366 |
| Molecular Formula | C11H20N3O6P |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [(1S)-1-[[(6S)-6-[(2-aminoacetyl)amino]-6-carboxyhexanoyl]amino]ethyl]-oxido-oxophosphanium |
| SMILES | C[C@@H](NC(=O)CCCC[C@H](NC(=O)CN)C(=O)O)[P+](=O)[O-] |
| InChI | InChI=1S/C11H20N3O6P/c1-7(21(19)20)13-9(15)5-3-2-4-8(11(17)18)14-10(16)6-12/h7-8H,2-6,12H2,1H3,(H,13,15)(H,14,16)(H,17,18)/t7-,8-/m0/s1 |
| InChIKey | YFLAHXPQGVRVPV-YUMQZZPRSA-N |
| XLogP | -1.36 |
| TPSA | 161.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|