C16H17Cl2N3 — CID 69145462
5-[1-amino-3-(4-chlorophenyl)butan-2-yl]pyridine-3-carbonitrile;hydrochloride (PubChem CID 69145462) has the molecular formula C16H17Cl2N3 and a molecular weight of 322.24 g/mol. Its IUPAC name is 5-[1-amino-3-(4-chlorophenyl)butan-2-yl]pyridine-3-carbonitrile;hydrochloride.
| Compound Name | 5-[1-amino-3-(4-chlorophenyl)butan-2-yl]pyridine-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 69145462 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[1-amino-3-(4-chlorophenyl)butan-2-yl]pyridine-3-carbonitrile;hydrochloride |
| SMILES | CC(c1ccc(Cl)cc1)C(CN)c1cncc(C#N)c1.Cl |
| InChI | InChI=1S/C16H16ClN3.ClH/c1-11(13-2-4-15(17)5-3-13)16(8-19)14-6-12(7-18)9-20-10-14;/h2-6,9-11,16H,8,19H2,1H3;1H |
| InChIKey | FVJCSLBCYDIHCE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |