C18H29N3O4S — CID 69147605
2-amino-N-[1-(benzenesulfonyl)-3-hydroxyazepan-4-yl]-N-methylpentanamide (PubChem CID 69147605) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-amino-N-[1-(benzenesulfonyl)-3-hydroxyazepan-4-yl]-N-methylpentanamide.
| Compound Name | 2-amino-N-[1-(benzenesulfonyl)-3-hydroxyazepan-4-yl]-N-methylpentanamide |
|---|---|
| PubChem CID | 69147605 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-amino-N-[1-(benzenesulfonyl)-3-hydroxyazepan-4-yl]-N-methylpentanamide |
| SMILES | CCCC(N)C(=O)N(C)C1CCCN(S(=O)(=O)c2ccccc2)CC1O |
| InChI | InChI=1S/C18H29N3O4S/c1-3-8-15(19)18(23)20(2)16-11-7-12-21(13-17(16)22)26(24,25)14-9-5-4-6-10-14/h4-6,9-10,15-17,22H,3,7-8,11-13,19H2,1-2H3 |
| InChIKey | BJEXMZURBRNDSR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |