C32H36ClFN2O3 — CID 69152970
tert-butyl 4-[1-[(3-chloronaphthalen-1-yl)methylamino]-1-oxopent-4-en-2-yl]-4-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 69152970) has the molecular formula C32H36ClFN2O3 and a molecular weight of 551.10 g/mol. Its IUPAC name is tert-butyl 4-[1-[(3-chloronaphthalen-1-yl)methylamino]-1-oxopent-4-en-2-yl]-4-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[(3-chloronaphthalen-1-yl)methylamino]-1-oxopent-4-en-2-yl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69152970 |
| Molecular Formula | C32H36ClFN2O3 |
| Molecular Weight | 551.10 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | tert-butyl 4-[1-[(3-chloronaphthalen-1-yl)methylamino]-1-oxopent-4-en-2-yl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | C=CCC(C(=O)NCc1cc(Cl)cc2ccccc12)C1(c2ccc(F)cc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C32H36ClFN2O3/c1-5-8-28(29(37)35-21-23-20-25(33)19-22-9-6-7-10-27(22)23)32(24-11-13-26(34)14-12-24)15-17-36(18-16-32)30(38)39-31(2,3)4/h5-7,9-14,19-20,28H,1,8,15-18,21H2,2-4H3,(H,35,37) |
| InChIKey | UFYHSEVFJNWERS-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.10 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|