About octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate
octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 69154607) has the molecular formula C20H37NO3
and a molecular weight of 339.52 g/mol. Its IUPAC name is octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
Molecular Properties
| Compound Name | octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| PubChem CID | 69154607 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCCCCC(CC)OC(=O)N1C2CCC1(C(C)(C)C)CC(O)C2 |
| InChI | InChI=1S/C20H37NO3/c1-6-8-9-10-17(7-2)24-18(23)21-15-11-12-20(21,19(3,4)5)14-16(22)13-15/h15-17,22H,6-14H2,1-5H3 |
| InChIKey | YSNGRANJAAGJFY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 69154607) is octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate is CCCCCC(CC)OC(=O)N1C2CCC1(C(C)(C)C)CC(O)C2.
What is the InChIKey of octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is YSNGRANJAAGJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO3/c1-6-8-9-10-17(7-2)24-18(23)21-15-11-12-20(21,19(3,4)5)14-16(22)13-15/h15-17,22H,6-14H2,1-5H3.
What are the key properties of octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 339.52 g/mol, XLogP of 4.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-3-yl 1-tert-butyl-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 69154607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).