C25H43NO2 — CID 69157610
pyridin-4-yl 3,7,11,15-tetramethylhexadecanoate (PubChem CID 69157610) has the molecular formula C25H43NO2 and a molecular weight of 389.62 g/mol. Its IUPAC name is pyridin-4-yl 3,7,11,15-tetramethylhexadecanoate.
| Compound Name | pyridin-4-yl 3,7,11,15-tetramethylhexadecanoate |
|---|---|
| PubChem CID | 69157610 |
| Molecular Formula | C25H43NO2 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | pyridin-4-yl 3,7,11,15-tetramethylhexadecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)Oc1ccncc1 |
| InChI | InChI=1S/C25H43NO2/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-14-23(5)19-25(27)28-24-15-17-26-18-16-24/h15-18,20-23H,6-14,19H2,1-5H3 |
| InChIKey | KZDIHUWZNYSILS-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |