C18H19N3O4S — CID 69157963
6-(3,5-dimethoxyphenyl)-11-oxo-11λ4-thia-2,8,12-triazatricyclo[6.3.2.04,13]trideca-1,3,5,12-tetraen-7-one;methane (PubChem CID 69157963) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 6-(3,5-dimethoxyphenyl)-11-oxo-11λ4-thia-2,8,12-triazatricyclo[6.3.2.04,13]trideca-1,3,5,12-tetraen-7-one;methane.
| Compound Name | 6-(3,5-dimethoxyphenyl)-11-oxo-11λ4-thia-2,8,12-triazatricyclo[6.3.2.04,13]trideca-1,3,5,12-tetraen-7-one;methane |
|---|---|
| PubChem CID | 69157963 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 6-(3,5-dimethoxyphenyl)-11-oxo-11λ4-thia-2,8,12-triazatricyclo[6.3.2.04,13]trideca-1,3,5,12-tetraen-7-one;methane |
| SMILES | C.COc1cc(OC)cc(-c2cc3cnc4nc3n(c2=O)CCS4=O)c1 |
| InChI | InChI=1S/C17H15N3O4S.CH4/c1-23-12-5-10(6-13(8-12)24-2)14-7-11-9-18-17-19-15(11)20(16(14)21)3-4-25(17)22;/h5-9H,3-4H2,1-2H3;1H4 |
| InChIKey | OCTBVDSFIMEZPZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |