C16H21N3O3S — CID 69205923
2-cyclopentyl-9-oxo-6-oxa-9λ4-thia-2,11,14-triazatricyclo[8.3.1.14,13]pentadeca-1(14),4(15),10,12-tetraen-3-one;methane (PubChem CID 69205923) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-cyclopentyl-9-oxo-6-oxa-9λ4-thia-2,11,14-triazatricyclo[8.3.1.14,13]pentadeca-1(14),4(15),10,12-tetraen-3-one;methane.
| Compound Name | 2-cyclopentyl-9-oxo-6-oxa-9λ4-thia-2,11,14-triazatricyclo[8.3.1.14,13]pentadeca-1(14),4(15),10,12-tetraen-3-one;methane |
|---|---|
| PubChem CID | 69205923 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-cyclopentyl-9-oxo-6-oxa-9λ4-thia-2,11,14-triazatricyclo[8.3.1.14,13]pentadeca-1(14),4(15),10,12-tetraen-3-one;methane |
| SMILES | C.O=c1c2cc3cnc(nc3n1C1CCCC1)S(=O)CCOC2 |
| InChI | InChI=1S/C15H17N3O3S.CH4/c19-14-11-7-10-8-16-15(22(20)6-5-21-9-11)17-13(10)18(14)12-3-1-2-4-12;/h7-8,12H,1-6,9H2;1H4 |
| InChIKey | LQSSYZZNWKHLBE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |