C15H19N3O2S — CID 69377142
methane;9-oxo-9λ4-thia-1,11,18-triazatetracyclo[8.6.2.02,8.013,17]octadeca-10,12,14,17-tetraen-16-one (PubChem CID 69377142) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is methane;9-oxo-9λ4-thia-1,11,18-triazatetracyclo[8.6.2.02,8.013,17]octadeca-10,12,14,17-tetraen-16-one.
| Compound Name | methane;9-oxo-9λ4-thia-1,11,18-triazatetracyclo[8.6.2.02,8.013,17]octadeca-10,12,14,17-tetraen-16-one |
|---|---|
| PubChem CID | 69377142 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methane;9-oxo-9λ4-thia-1,11,18-triazatetracyclo[8.6.2.02,8.013,17]octadeca-10,12,14,17-tetraen-16-one |
| SMILES | C.O=c1ccc2cnc3nc2n1C1CCCCCC1S3=O |
| InChI | InChI=1S/C14H15N3O2S.CH4/c18-12-7-6-9-8-15-14-16-13(9)17(12)10-4-2-1-3-5-11(10)20(14)19;/h6-8,10-11H,1-5H2;1H4 |
| InChIKey | WJGXRMVPESBBBM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |