C16H16N4O3S — CID 175057647
12-methyl-7-oxo-13-(2-oxoazetidin-1-yl)-7λ4-thia-1,9,16-triazatetracyclo[6.6.2.02,6.011,15]hexadeca-8,10,12,15-tetraen-14-one (PubChem CID 175057647) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 12-methyl-7-oxo-13-(2-oxoazetidin-1-yl)-7λ4-thia-1,9,16-triazatetracyclo[6.6.2.02,6.011,15]hexadeca-8,10,12,15-tetraen-14-one.
| Compound Name | 12-methyl-7-oxo-13-(2-oxoazetidin-1-yl)-7λ4-thia-1,9,16-triazatetracyclo[6.6.2.02,6.011,15]hexadeca-8,10,12,15-tetraen-14-one |
|---|---|
| PubChem CID | 175057647 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 12-methyl-7-oxo-13-(2-oxoazetidin-1-yl)-7λ4-thia-1,9,16-triazatetracyclo[6.6.2.02,6.011,15]hexadeca-8,10,12,15-tetraen-14-one |
| SMILES | Cc1c(N2CCC2=O)c(=O)n2c3nc(ncc13)S(=O)C1CCCC12 |
| InChI | InChI=1S/C16H16N4O3S/c1-8-9-7-17-16-18-14(9)20(10-3-2-4-11(10)24(16)23)15(22)13(8)19-6-5-12(19)21/h7,10-11H,2-6H2,1H3 |
| InChIKey | ULQVLDZSWCJFDE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |