C8H18N2O2S — CID 69158754
1-(aminomethyl)-4-[(sulfinoamino)methyl]cyclohexane (PubChem CID 69158754) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 1-(aminomethyl)-4-[(sulfinoamino)methyl]cyclohexane.
| Compound Name | 1-(aminomethyl)-4-[(sulfinoamino)methyl]cyclohexane |
|---|---|
| PubChem CID | 69158754 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(aminomethyl)-4-[(sulfinoamino)methyl]cyclohexane |
| SMILES | NCC1CCC(CNS(=O)O)CC1 |
| InChI | InChI=1S/C8H18N2O2S/c9-5-7-1-3-8(4-2-7)6-10-13(11)12/h7-8,10H,1-6,9H2,(H,11,12) |
| InChIKey | MRVSGXFZTROONN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|